C18H17F2NO3 — CID 110016234
N-[2-(3,5-difluorophenoxy)phenyl]-2-hydroxycyclopentane-1-carboxamide (PubChem CID 110016234) has the molecular formula C18H17F2NO3 and a molecular weight of 333.33 g/mol. Its IUPAC name is N-[2-(3,5-difluorophenoxy)phenyl]-2-hydroxycyclopentane-1-carboxamide.
| Compound Name | N-[2-(3,5-difluorophenoxy)phenyl]-2-hydroxycyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 110016234 |
| Molecular Formula | C18H17F2NO3 |
| Molecular Weight | 333.33 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | N-[2-(3,5-difluorophenoxy)phenyl]-2-hydroxycyclopentane-1-carboxamide |
| SMILES | O=C(Nc1ccccc1Oc1cc(F)cc(F)c1)C1CCCC1O |
| InChI | InChI=1S/C18H17F2NO3/c19-11-8-12(20)10-13(9-11)24-17-7-2-1-5-15(17)21-18(23)14-4-3-6-16(14)22/h1-2,5,7-10,14,16,22H,3-4,6H2,(H,21,23) |
| InChIKey | SMUJZGJNDNBZJA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.33 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |