C17H16F2N2O3 — CID 75520270
N-[2-(3,5-difluorophenoxy)phenyl]-3-hydroxypyrrolidine-1-carboxamide (PubChem CID 75520270) has the molecular formula C17H16F2N2O3 and a molecular weight of 334.32 g/mol. Its IUPAC name is N-[2-(3,5-difluorophenoxy)phenyl]-3-hydroxypyrrolidine-1-carboxamide.
| Compound Name | N-[2-(3,5-difluorophenoxy)phenyl]-3-hydroxypyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 75520270 |
| Molecular Formula | C17H16F2N2O3 |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | N-[2-(3,5-difluorophenoxy)phenyl]-3-hydroxypyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1ccccc1Oc1cc(F)cc(F)c1)N1CCC(O)C1 |
| InChI | InChI=1S/C17H16F2N2O3/c18-11-7-12(19)9-14(8-11)24-16-4-2-1-3-15(16)20-17(23)21-6-5-13(22)10-21/h1-4,7-9,13,22H,5-6,10H2,(H,20,23) |
| InChIKey | WPXFPUIQFXUHDX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |