C18H26FIN6S — CID 119157507
1-ethyl-2-[(5-fluoro-2-methylsulfanylphenyl)methyl]-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)guanidine;hydroiodide (PubChem CID 119157507) has the molecular formula C18H26FIN6S and a molecular weight of 504.42 g/mol. Its IUPAC name is 1-ethyl-2-[(5-fluoro-2-methylsulfanylphenyl)methyl]-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(5-fluoro-2-methylsulfanylphenyl)methyl]-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119157507 |
| Molecular Formula | C18H26FIN6S |
| Molecular Weight | 504.42 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | 1-ethyl-2-[(5-fluoro-2-methylsulfanylphenyl)methyl]-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(F)ccc1SC)NC1CCCn2nc(C)nc21.I |
| InChI | InChI=1S/C18H25FN6S.HI/c1-4-20-18(21-11-13-10-14(19)7-8-16(13)26-3)23-15-6-5-9-25-17(15)22-12(2)24-25;/h7-8,10,15H,4-6,9,11H2,1-3H3,(H2,20,21,23);1H |
| InChIKey | OGIYMGBQLMDMQW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.42 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|