C19H31F2IN4O — CID 111760372
1-[2-(2,4-difluorophenyl)propyl]-3-ethyl-2-(2-morpholin-4-ylpropyl)guanidine;hydroiodide (PubChem CID 111760372) has the molecular formula C19H31F2IN4O and a molecular weight of 496.38 g/mol. Its IUPAC name is 1-[2-(2,4-difluorophenyl)propyl]-3-ethyl-2-(2-morpholin-4-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(2,4-difluorophenyl)propyl]-3-ethyl-2-(2-morpholin-4-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111760372 |
| Molecular Formula | C19H31F2IN4O |
| Molecular Weight | 496.38 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | 1-[2-(2,4-difluorophenyl)propyl]-3-ethyl-2-(2-morpholin-4-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)N1CCOCC1)NCC(C)c1ccc(F)cc1F.I |
| InChI | InChI=1S/C19H30F2N4O.HI/c1-4-22-19(24-13-15(3)25-7-9-26-10-8-25)23-12-14(2)17-6-5-16(20)11-18(17)21;/h5-6,11,14-15H,4,7-10,12-13H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | SCBNANHAZONFOG-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|