C20H32FN5O2 — CID 111020979
2-[[[N-ethyl-N'-(2-morpholin-4-ylpropyl)carbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide (PubChem CID 111020979) has the molecular formula C20H32FN5O2 and a molecular weight of 393.51 g/mol. Its IUPAC name is 2-[[[N-ethyl-N'-(2-morpholin-4-ylpropyl)carbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide.
| Compound Name | 2-[[[N-ethyl-N'-(2-morpholin-4-ylpropyl)carbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 111020979 |
| Molecular Formula | C20H32FN5O2 |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | 2-[[[N-ethyl-N'-(2-morpholin-4-ylpropyl)carbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide |
| SMILES | CCN/C(=N\CC(C)N1CCOCC1)NCC(Cc1ccc(F)cc1)C(N)=O |
| InChI | InChI=1S/C20H32FN5O2/c1-3-23-20(24-13-15(2)26-8-10-28-11-9-26)25-14-17(19(22)27)12-16-4-6-18(21)7-5-16/h4-7,15,17H,3,8-14H2,1-2H3,(H2,22,27)(H2,23,24,25) |
| InChIKey | MNAWRNLILBZOPQ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|