C22H29FN4O — CID 111343473
2-[[[N-ethyl-N'-(2-phenylpropyl)carbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide (PubChem CID 111343473) has the molecular formula C22H29FN4O and a molecular weight of 384.50 g/mol. Its IUPAC name is 2-[[[N-ethyl-N'-(2-phenylpropyl)carbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide.
| Compound Name | 2-[[[N-ethyl-N'-(2-phenylpropyl)carbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 111343473 |
| Molecular Formula | C22H29FN4O |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 2-[[[N-ethyl-N'-(2-phenylpropyl)carbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide |
| SMILES | CCN/C(=N\CC(C)c1ccccc1)NCC(Cc1ccc(F)cc1)C(N)=O |
| InChI | InChI=1S/C22H29FN4O/c1-3-25-22(26-14-16(2)18-7-5-4-6-8-18)27-15-19(21(24)28)13-17-9-11-20(23)12-10-17/h4-12,16,19H,3,13-15H2,1-2H3,(H2,24,28)(H2,25,26,27) |
| InChIKey | URNKMJSYXYAXIV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|