C24H39FIN5O2 — CID 111003234
2-[[[N-ethyl-N'-[(1-morpholin-4-ylcyclohexyl)methyl]carbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide;hydroiodide (PubChem CID 111003234) has the molecular formula C24H39FIN5O2 and a molecular weight of 575.51 g/mol. Its IUPAC name is 2-[[[N-ethyl-N'-[(1-morpholin-4-ylcyclohexyl)methyl]carbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide;hydroiodide.
| Compound Name | 2-[[[N-ethyl-N'-[(1-morpholin-4-ylcyclohexyl)methyl]carbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide;hydroiodide |
|---|---|
| PubChem CID | 111003234 |
| Molecular Formula | C24H39FIN5O2 |
| Molecular Weight | 575.51 g/mol |
| Exact Mass | 575.21 |
| IUPAC Name | 2-[[[N-ethyl-N'-[(1-morpholin-4-ylcyclohexyl)methyl]carbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide;hydroiodide |
| SMILES | CCN/C(=N\CC1(N2CCOCC2)CCCCC1)NCC(Cc1ccc(F)cc1)C(N)=O.I |
| InChI | InChI=1S/C24H38FN5O2.HI/c1-2-27-23(28-17-20(22(26)31)16-19-6-8-21(25)9-7-19)29-18-24(10-4-3-5-11-24)30-12-14-32-15-13-30;/h6-9,20H,2-5,10-18H2,1H3,(H2,26,31)(H2,27,28,29);1H |
| InChIKey | SCONETPYSKQVTN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.51 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|