C24H38FN5O2 — CID 111003637
N-[2-[[N-ethyl-N'-[(1-morpholin-4-ylcyclohexyl)methyl]carbamimidoyl]amino]ethyl]-2-(3-fluorophenyl)acetamide (PubChem CID 111003637) has the molecular formula C24H38FN5O2 and a molecular weight of 447.60 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[(1-morpholin-4-ylcyclohexyl)methyl]carbamimidoyl]amino]ethyl]-2-(3-fluorophenyl)acetamide.
| Compound Name | N-[2-[[N-ethyl-N'-[(1-morpholin-4-ylcyclohexyl)methyl]carbamimidoyl]amino]ethyl]-2-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 111003637 |
| Molecular Formula | C24H38FN5O2 |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.30 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[(1-morpholin-4-ylcyclohexyl)methyl]carbamimidoyl]amino]ethyl]-2-(3-fluorophenyl)acetamide |
| SMILES | CCN/C(=N\CC1(N2CCOCC2)CCCCC1)NCCNC(=O)Cc1cccc(F)c1 |
| InChI | InChI=1S/C24H38FN5O2/c1-2-26-23(28-12-11-27-22(31)18-20-7-6-8-21(25)17-20)29-19-24(9-4-3-5-10-24)30-13-15-32-16-14-30/h6-8,17H,2-5,9-16,18-19H2,1H3,(H,27,31)(H2,26,28,29) |
| InChIKey | RCVCDJREGPATKQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|