C14H20F2IN3O — CID 111548994
1-cyclopropyl-2-[2-(3,4-difluorophenoxy)ethyl]-3-ethylguanidine;hydroiodide (PubChem CID 111548994) has the molecular formula C14H20F2IN3O and a molecular weight of 411.23 g/mol. Its IUPAC name is 1-cyclopropyl-2-[2-(3,4-difluorophenoxy)ethyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-cyclopropyl-2-[2-(3,4-difluorophenoxy)ethyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111548994 |
| Molecular Formula | C14H20F2IN3O |
| Molecular Weight | 411.23 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | 1-cyclopropyl-2-[2-(3,4-difluorophenoxy)ethyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CCOc1ccc(F)c(F)c1)NC1CC1.I |
| InChI | InChI=1S/C14H19F2N3O.HI/c1-2-17-14(19-10-3-4-10)18-7-8-20-11-5-6-12(15)13(16)9-11;/h5-6,9-10H,2-4,7-8H2,1H3,(H2,17,18,19);1H |
| InChIKey | PBVNECHRDVAJBJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.23 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|