C24H32IN3O — CID 109392523
1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-(2,2-diphenylethyl)-3-ethylguanidine;hydroiodide (PubChem CID 109392523) has the molecular formula C24H32IN3O and a molecular weight of 505.44 g/mol. Its IUPAC name is 1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-(2,2-diphenylethyl)-3-ethylguanidine;hydroiodide.
| Compound Name | 1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-(2,2-diphenylethyl)-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109392523 |
| Molecular Formula | C24H32IN3O |
| Molecular Weight | 505.44 g/mol |
| Exact Mass | 505.16 |
| IUPAC Name | 1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-(2,2-diphenylethyl)-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(c1ccccc1)c1ccccc1)NCCC1=CCOCC1.I |
| InChI | InChI=1S/C24H31N3O.HI/c1-2-25-24(26-16-13-20-14-17-28-18-15-20)27-19-23(21-9-5-3-6-10-21)22-11-7-4-8-12-22;/h3-12,14,23H,2,13,15-19H2,1H3,(H2,25,26,27);1H |
| InChIKey | DLQXYHXJQXABEW-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|