C18H25F3IN3O2 — CID 109396072
1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-ethyl-2-[[2-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 109396072) has the molecular formula C18H25F3IN3O2 and a molecular weight of 499.32 g/mol. Its IUPAC name is 1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-ethyl-2-[[2-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-ethyl-2-[[2-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109396072 |
| Molecular Formula | C18H25F3IN3O2 |
| Molecular Weight | 499.32 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | 1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-ethyl-2-[[2-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1OC(F)(F)F)NCCC1=CCOCC1.I |
| InChI | InChI=1S/C18H24F3N3O2.HI/c1-2-22-17(23-10-7-14-8-11-25-12-9-14)24-13-15-5-3-4-6-16(15)26-18(19,20)21;/h3-6,8H,2,7,9-13H2,1H3,(H2,22,23,24);1H |
| InChIKey | RZMDXJCYSLRXCC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.32 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|