C15H24IN3OS — CID 109396568
1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-ethyl-2-(thiophen-3-ylmethyl)guanidine;hydroiodide (PubChem CID 109396568) has the molecular formula C15H24IN3OS and a molecular weight of 421.35 g/mol. Its IUPAC name is 1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-ethyl-2-(thiophen-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-ethyl-2-(thiophen-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109396568 |
| Molecular Formula | C15H24IN3OS |
| Molecular Weight | 421.35 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | 1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-ethyl-2-(thiophen-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccsc1)NCCC1=CCOCC1.I |
| InChI | InChI=1S/C15H23N3OS.HI/c1-2-16-15(18-11-14-6-10-20-12-14)17-7-3-13-4-8-19-9-5-13;/h4,6,10,12H,2-3,5,7-9,11H2,1H3,(H2,16,17,18);1H |
| InChIKey | ZVTNCTHKVJJRFQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|