C20H29BrIN5 — CID 111572708
2-[[1-(3-bromophenyl)cyclopropyl]methyl]-1-ethyl-3-[3-(1-methylpyrazol-4-yl)propyl]guanidine;hydroiodide (PubChem CID 111572708) has the molecular formula C20H29BrIN5 and a molecular weight of 546.30 g/mol. Its IUPAC name is 2-[[1-(3-bromophenyl)cyclopropyl]methyl]-1-ethyl-3-[3-(1-methylpyrazol-4-yl)propyl]guanidine;hydroiodide.
| Compound Name | 2-[[1-(3-bromophenyl)cyclopropyl]methyl]-1-ethyl-3-[3-(1-methylpyrazol-4-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111572708 |
| Molecular Formula | C20H29BrIN5 |
| Molecular Weight | 546.30 g/mol |
| Exact Mass | 545.07 |
| IUPAC Name | 2-[[1-(3-bromophenyl)cyclopropyl]methyl]-1-ethyl-3-[3-(1-methylpyrazol-4-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1(c2cccc(Br)c2)CC1)NCCCc1cnn(C)c1.I |
| InChI | InChI=1S/C20H28BrN5.HI/c1-3-22-19(23-11-5-6-16-13-25-26(2)14-16)24-15-20(9-10-20)17-7-4-8-18(21)12-17;/h4,7-8,12-14H,3,5-6,9-11,15H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | XQCCVNVUMOBADA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.30 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|