C20H28BrN5 — CID 111572811
2-[[1-(3-bromophenyl)cyclopropyl]methyl]-1-ethyl-3-[3-(5-methyl-1H-pyrazol-4-yl)propyl]guanidine (PubChem CID 111572811) has the molecular formula C20H28BrN5 and a molecular weight of 418.38 g/mol. Its IUPAC name is 2-[[1-(3-bromophenyl)cyclopropyl]methyl]-1-ethyl-3-[3-(5-methyl-1H-pyrazol-4-yl)propyl]guanidine.
| Compound Name | 2-[[1-(3-bromophenyl)cyclopropyl]methyl]-1-ethyl-3-[3-(5-methyl-1H-pyrazol-4-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111572811 |
| Molecular Formula | C20H28BrN5 |
| Molecular Weight | 418.38 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 2-[[1-(3-bromophenyl)cyclopropyl]methyl]-1-ethyl-3-[3-(5-methyl-1H-pyrazol-4-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CC1(c2cccc(Br)c2)CC1)NCCCc1cn[nH]c1C |
| InChI | InChI=1S/C20H28BrN5/c1-3-22-19(23-11-5-6-16-13-25-26-15(16)2)24-14-20(9-10-20)17-7-4-8-18(21)12-17/h4,7-8,12-13H,3,5-6,9-11,14H2,1-2H3,(H,25,26)(H2,22,23,24) |
| InChIKey | HISHLUJWIQTVNU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|