C13H17BrS — CID 115052251
1-bromo-3-[1-(ethylsulfanylmethyl)cyclobutyl]benzene (PubChem CID 115052251) has the molecular formula C13H17BrS and a molecular weight of 285.25 g/mol. Its IUPAC name is 1-bromo-3-[1-(ethylsulfanylmethyl)cyclobutyl]benzene.
| Compound Name | 1-bromo-3-[1-(ethylsulfanylmethyl)cyclobutyl]benzene |
|---|---|
| PubChem CID | 115052251 |
| Molecular Formula | C13H17BrS |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 1-bromo-3-[1-(ethylsulfanylmethyl)cyclobutyl]benzene |
| SMILES | CCSCC1(c2cccc(Br)c2)CCC1 |
| InChI | InChI=1S/C13H17BrS/c1-2-15-10-13(7-4-8-13)11-5-3-6-12(14)9-11/h3,5-6,9H,2,4,7-8,10H2,1H3 |
| InChIKey | VHQAFOWWYFOCTI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |