C18H31IN4OS — CID 111037535
N'-[2-(diethylamino)-2-(3-methoxyphenyl)ethyl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 111037535) has the molecular formula C18H31IN4OS and a molecular weight of 478.44 g/mol. Its IUPAC name is N'-[2-(diethylamino)-2-(3-methoxyphenyl)ethyl]thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(diethylamino)-2-(3-methoxyphenyl)ethyl]thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111037535 |
| Molecular Formula | C18H31IN4OS |
| Molecular Weight | 478.44 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | N'-[2-(diethylamino)-2-(3-methoxyphenyl)ethyl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CCN(CC)C(C/N=C(\N)N1CCSCC1)c1cccc(OC)c1.I |
| InChI | InChI=1S/C18H30N4OS.HI/c1-4-21(5-2)17(15-7-6-8-16(13-15)23-3)14-20-18(19)22-9-11-24-12-10-22;/h6-8,13,17H,4-5,9-12,14H2,1-3H3,(H2,19,20);1H |
| InChIKey | MMWKAGZKJBSGRV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 54.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|