C13H22N2O — CID 9450069
(1S)-N,N-diethyl-1-(3-methoxyphenyl)ethane-1,2-diamine (PubChem CID 9450069) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is (1S)-N,N-diethyl-1-(3-methoxyphenyl)ethane-1,2-diamine.
| Compound Name | (1S)-N,N-diethyl-1-(3-methoxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 9450069 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | (1S)-N,N-diethyl-1-(3-methoxyphenyl)ethane-1,2-diamine |
| SMILES | CCN(CC)[C@H](CN)c1cccc(OC)c1 |
| InChI | InChI=1S/C13H22N2O/c1-4-15(5-2)13(10-14)11-7-6-8-12(9-11)16-3/h6-9,13H,4-5,10,14H2,1-3H3/t13-/m1/s1 |
| InChIKey | FDSWKHRJTLVBAX-CYBMUJFWSA-N |
| XLogP | 2.04 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |