C14H24N2O2 — CID 16642878
1-(2,5-dimethoxyphenyl)-N,N-diethylethane-1,2-diamine (PubChem CID 16642878) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-N,N-diethylethane-1,2-diamine.
| Compound Name | 1-(2,5-dimethoxyphenyl)-N,N-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 16642878 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-N,N-diethylethane-1,2-diamine |
| SMILES | CCN(CC)C(CN)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C14H24N2O2/c1-5-16(6-2)13(10-15)12-9-11(17-3)7-8-14(12)18-4/h7-9,13H,5-6,10,15H2,1-4H3 |
| InChIKey | XIUMYHQBPVYCLZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |