C16H28N2O3 — CID 43268553
N-ethyl-N-propyl-1-(2,4,5-trimethoxyphenyl)ethane-1,2-diamine (PubChem CID 43268553) has the molecular formula C16H28N2O3 and a molecular weight of 296.41 g/mol. Its IUPAC name is N-ethyl-N-propyl-1-(2,4,5-trimethoxyphenyl)ethane-1,2-diamine.
| Compound Name | N-ethyl-N-propyl-1-(2,4,5-trimethoxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 43268553 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | N-ethyl-N-propyl-1-(2,4,5-trimethoxyphenyl)ethane-1,2-diamine |
| SMILES | CCCN(CC)C(CN)c1cc(OC)c(OC)cc1OC |
| InChI | InChI=1S/C16H28N2O3/c1-6-8-18(7-2)13(11-17)12-9-15(20-4)16(21-5)10-14(12)19-3/h9-10,13H,6-8,11,17H2,1-5H3 |
| InChIKey | FIRXOAQYPRGKJY-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |