C15H25ClN2O — CID 65021962
1-(3-chloro-4-methoxyphenyl)-N,N-dipropylethane-1,2-diamine (PubChem CID 65021962) has the molecular formula C15H25ClN2O and a molecular weight of 284.83 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-N,N-dipropylethane-1,2-diamine.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-N,N-dipropylethane-1,2-diamine |
|---|---|
| PubChem CID | 65021962 |
| Molecular Formula | C15H25ClN2O |
| Molecular Weight | 284.83 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-N,N-dipropylethane-1,2-diamine |
| SMILES | CCCN(CCC)C(CN)c1ccc(OC)c(Cl)c1 |
| InChI | InChI=1S/C15H25ClN2O/c1-4-8-18(9-5-2)14(11-17)12-6-7-15(19-3)13(16)10-12/h6-7,10,14H,4-5,8-9,11,17H2,1-3H3 |
| InChIKey | HEOGTTAMSWWUID-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.83 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |