C14H22ClFN2 — CID 81145990
1-(3-chloro-4-fluorophenyl)-N,N-dipropylethane-1,2-diamine (PubChem CID 81145990) has the molecular formula C14H22ClFN2 and a molecular weight of 272.80 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-N,N-dipropylethane-1,2-diamine.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-N,N-dipropylethane-1,2-diamine |
|---|---|
| PubChem CID | 81145990 |
| Molecular Formula | C14H22ClFN2 |
| Molecular Weight | 272.80 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-N,N-dipropylethane-1,2-diamine |
| SMILES | CCCN(CCC)C(CN)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C14H22ClFN2/c1-3-7-18(8-4-2)14(10-17)11-5-6-13(16)12(15)9-11/h5-6,9,14H,3-4,7-8,10,17H2,1-2H3 |
| InChIKey | RVCPDGQFOAMXKP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.80 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |