C14H22F2N2 — CID 16794999
1-(2,6-difluorophenyl)-N,N-dipropylethane-1,2-diamine (PubChem CID 16794999) has the molecular formula C14H22F2N2 and a molecular weight of 256.34 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-N,N-dipropylethane-1,2-diamine.
| Compound Name | 1-(2,6-difluorophenyl)-N,N-dipropylethane-1,2-diamine |
|---|---|
| PubChem CID | 16794999 |
| Molecular Formula | C14H22F2N2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 1-(2,6-difluorophenyl)-N,N-dipropylethane-1,2-diamine |
| SMILES | CCCN(CCC)C(CN)c1c(F)cccc1F |
| InChI | InChI=1S/C14H22F2N2/c1-3-8-18(9-4-2)13(10-17)14-11(15)6-5-7-12(14)16/h5-7,13H,3-4,8-10,17H2,1-2H3 |
| InChIKey | QINZBCZEBSRESI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |