C16H24F2N2 — CID 43180409
N-cyclohexyl-1-(2,6-difluorophenyl)-N-ethylethane-1,2-diamine (PubChem CID 43180409) has the molecular formula C16H24F2N2 and a molecular weight of 282.38 g/mol. Its IUPAC name is N-cyclohexyl-1-(2,6-difluorophenyl)-N-ethylethane-1,2-diamine.
| Compound Name | N-cyclohexyl-1-(2,6-difluorophenyl)-N-ethylethane-1,2-diamine |
|---|---|
| PubChem CID | 43180409 |
| Molecular Formula | C16H24F2N2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | N-cyclohexyl-1-(2,6-difluorophenyl)-N-ethylethane-1,2-diamine |
| SMILES | CCN(C1CCCCC1)C(CN)c1c(F)cccc1F |
| InChI | InChI=1S/C16H24F2N2/c1-2-20(12-7-4-3-5-8-12)15(11-19)16-13(17)9-6-10-14(16)18/h6,9-10,12,15H,2-5,7-8,11,19H2,1H3 |
| InChIKey | NEFUBYIEMKHLCI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |