C16H24Cl2N2 — CID 60790302
N-cyclohexyl-1-(3,5-dichlorophenyl)-N-ethylethane-1,2-diamine (PubChem CID 60790302) has the molecular formula C16H24Cl2N2 and a molecular weight of 315.29 g/mol. Its IUPAC name is N-cyclohexyl-1-(3,5-dichlorophenyl)-N-ethylethane-1,2-diamine.
| Compound Name | N-cyclohexyl-1-(3,5-dichlorophenyl)-N-ethylethane-1,2-diamine |
|---|---|
| PubChem CID | 60790302 |
| Molecular Formula | C16H24Cl2N2 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | N-cyclohexyl-1-(3,5-dichlorophenyl)-N-ethylethane-1,2-diamine |
| SMILES | CCN(C1CCCCC1)C(CN)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C16H24Cl2N2/c1-2-20(15-6-4-3-5-7-15)16(11-19)12-8-13(17)10-14(18)9-12/h8-10,15-16H,2-7,11,19H2,1H3 |
| InChIKey | OJYXERNAGWZTGZ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |