C12H18ClFN2 — CID 81145758
1-(3-chloro-4-fluorophenyl)-N,N-diethylethane-1,2-diamine (PubChem CID 81145758) has the molecular formula C12H18ClFN2 and a molecular weight of 244.74 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-N,N-diethylethane-1,2-diamine.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-N,N-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 81145758 |
| Molecular Formula | C12H18ClFN2 |
| Molecular Weight | 244.74 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-N,N-diethylethane-1,2-diamine |
| SMILES | CCN(CC)C(CN)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C12H18ClFN2/c1-3-16(4-2)12(8-15)9-5-6-11(14)10(13)7-9/h5-7,12H,3-4,8,15H2,1-2H3 |
| InChIKey | MZLGRBGUAYRWQA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.74 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |