C13H20ClNO — CID 112508549
2-chloro-N,N-diethyl-1-(3-methoxyphenyl)ethanamine (PubChem CID 112508549) has the molecular formula C13H20ClNO and a molecular weight of 241.76 g/mol. Its IUPAC name is 2-chloro-N,N-diethyl-1-(3-methoxyphenyl)ethanamine.
| Compound Name | 2-chloro-N,N-diethyl-1-(3-methoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 112508549 |
| Molecular Formula | C13H20ClNO |
| Molecular Weight | 241.76 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 2-chloro-N,N-diethyl-1-(3-methoxyphenyl)ethanamine |
| SMILES | CCN(CC)C(CCl)c1cccc(OC)c1 |
| InChI | InChI=1S/C13H20ClNO/c1-4-15(5-2)13(10-14)11-7-6-8-12(9-11)16-3/h6-9,13H,4-5,10H2,1-3H3 |
| InChIKey | GUKKWMBSGTYVNL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.76 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|