C12H18ClNO — CID 116907619
3-chloro-1-(3-methoxyphenyl)-N,N-dimethylpropan-1-amine (PubChem CID 116907619) has the molecular formula C12H18ClNO and a molecular weight of 227.74 g/mol. Its IUPAC name is 3-chloro-1-(3-methoxyphenyl)-N,N-dimethylpropan-1-amine.
| Compound Name | 3-chloro-1-(3-methoxyphenyl)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 116907619 |
| Molecular Formula | C12H18ClNO |
| Molecular Weight | 227.74 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 3-chloro-1-(3-methoxyphenyl)-N,N-dimethylpropan-1-amine |
| SMILES | COc1cccc(C(CCCl)N(C)C)c1 |
| InChI | InChI=1S/C12H18ClNO/c1-14(2)12(7-8-13)10-5-4-6-11(9-10)15-3/h4-6,9,12H,7-8H2,1-3H3 |
| InChIKey | SYGHAAXNLJOTNW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.74 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|