C12H16N2O2 — CID 63109938
2-isocyanato-1-(3-methoxyphenyl)-N,N-dimethylethanamine (PubChem CID 63109938) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 2-isocyanato-1-(3-methoxyphenyl)-N,N-dimethylethanamine.
| Compound Name | 2-isocyanato-1-(3-methoxyphenyl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 63109938 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 2-isocyanato-1-(3-methoxyphenyl)-N,N-dimethylethanamine |
| SMILES | COc1cccc(C(CN=C=O)N(C)C)c1 |
| InChI | InChI=1S/C12H16N2O2/c1-14(2)12(8-13-9-15)10-5-4-6-11(7-10)16-3/h4-7,12H,8H2,1-3H3 |
| InChIKey | AJLNVHAMHHPFAY-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|