C16H20F4N4 — CID 120973301
4-(4-fluorophenyl)-N'-[[1-(trifluoromethyl)cyclopropyl]methyl]piperazine-1-carboximidamide (PubChem CID 120973301) has the molecular formula C16H20F4N4 and a molecular weight of 344.36 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N'-[[1-(trifluoromethyl)cyclopropyl]methyl]piperazine-1-carboximidamide.
| Compound Name | 4-(4-fluorophenyl)-N'-[[1-(trifluoromethyl)cyclopropyl]methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 120973301 |
| Molecular Formula | C16H20F4N4 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 4-(4-fluorophenyl)-N'-[[1-(trifluoromethyl)cyclopropyl]methyl]piperazine-1-carboximidamide |
| SMILES | N/C(=N\CC1(C(F)(F)F)CC1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H20F4N4/c17-12-1-3-13(4-2-12)23-7-9-24(10-8-23)14(21)22-11-15(5-6-15)16(18,19)20/h1-4H,5-11H2,(H2,21,22) |
| InChIKey | ZCRXQRRXUZPNTI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|