C27H37N2O2+ — CID 69231329
[(3R)-1-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)pyrrolidin-3-yl]-dimethyl-(2-phenylethyl)azanium (PubChem CID 69231329) has the molecular formula C27H37N2O2+ and a molecular weight of 421.61 g/mol. Its IUPAC name is [(3R)-1-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)pyrrolidin-3-yl]-dimethyl-(2-phenylethyl)azanium.
| Compound Name | [(3R)-1-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)pyrrolidin-3-yl]-dimethyl-(2-phenylethyl)azanium |
|---|---|
| PubChem CID | 69231329 |
| Molecular Formula | C27H37N2O2+ |
| Molecular Weight | 421.61 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | [(3R)-1-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)pyrrolidin-3-yl]-dimethyl-(2-phenylethyl)azanium |
| SMILES | C[N+](C)(CCc1ccccc1)[C@@H]1CCN(C(=O)C(O)(c2ccccc2)C2CCCC2)C1 |
| InChI | InChI=1S/C27H37N2O2/c1-29(2,20-18-22-11-5-3-6-12-22)25-17-19-28(21-25)26(30)27(31,24-15-9-10-16-24)23-13-7-4-8-14-23/h3-8,11-14,24-25,31H,9-10,15-21H2,1-2H3/q+1/t25-,27?/m1/s1 |
| InChIKey | WBWIUHOSFUGXFA-CSMDKSQMSA-N |
| XLogP | 3.98 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.61 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|