C30H41N4O2+ — CID 154105590
[1-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)piperidin-4-yl]-methyl-(2-pyrrol-1-ylethyl)-(pyrrol-1-ylmethyl)azanium (PubChem CID 154105590) has the molecular formula C30H41N4O2+ and a molecular weight of 489.68 g/mol. Its IUPAC name is [1-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)piperidin-4-yl]-methyl-(2-pyrrol-1-ylethyl)-(pyrrol-1-ylmethyl)azanium.
| Compound Name | [1-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)piperidin-4-yl]-methyl-(2-pyrrol-1-ylethyl)-(pyrrol-1-ylmethyl)azanium |
|---|---|
| PubChem CID | 154105590 |
| Molecular Formula | C30H41N4O2+ |
| Molecular Weight | 489.68 g/mol |
| Exact Mass | 489.32 |
| IUPAC Name | [1-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)piperidin-4-yl]-methyl-(2-pyrrol-1-ylethyl)-(pyrrol-1-ylmethyl)azanium |
| SMILES | C[N+](CCn1cccc1)(Cn1cccc1)C1CCN(C(=O)C(O)(c2ccccc2)C2CCCC2)CC1 |
| InChI | InChI=1S/C30H41N4O2/c1-34(25-32-19-9-10-20-32,24-23-31-17-7-8-18-31)28-15-21-33(22-16-28)29(35)30(36,27-13-5-6-14-27)26-11-3-2-4-12-26/h2-4,7-12,17-20,27-28,36H,5-6,13-16,21-25H2,1H3/q+1 |
| InChIKey | BOWFFTMNFHWPDC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 50.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.68 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|