C29H36N3O3+ — CID 154485266
[2-(4-cyanophenyl)-2-oxoethyl]-[1-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)piperidin-4-yl]-dimethylazanium (PubChem CID 154485266) has the molecular formula C29H36N3O3+ and a molecular weight of 474.63 g/mol. Its IUPAC name is [2-(4-cyanophenyl)-2-oxoethyl]-[1-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)piperidin-4-yl]-dimethylazanium.
| Compound Name | [2-(4-cyanophenyl)-2-oxoethyl]-[1-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)piperidin-4-yl]-dimethylazanium |
|---|---|
| PubChem CID | 154485266 |
| Molecular Formula | C29H36N3O3+ |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | [2-(4-cyanophenyl)-2-oxoethyl]-[1-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)piperidin-4-yl]-dimethylazanium |
| SMILES | C[N+](C)(CC(=O)c1ccc(C#N)cc1)C1CCN(C(=O)C(O)(c2ccccc2)C2CCCC2)CC1 |
| InChI | InChI=1S/C29H36N3O3/c1-32(2,21-27(33)23-14-12-22(20-30)13-15-23)26-16-18-31(19-17-26)28(34)29(35,25-10-6-7-11-25)24-8-4-3-5-9-24/h3-5,8-9,12-15,25-26,35H,6-7,10-11,16-19,21H2,1-2H3/q+1 |
| InChIKey | LBKIEAWIOHBZAG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|