C28H39N2O4+ — CID 154106182
[1-[(2S)-2-cyclopentyl-2-hydroxy-2-phenylacetyl]-4-hydroxypiperidin-4-yl]-[2-(4-hydroxyphenyl)ethyl]-dimethylazanium (PubChem CID 154106182) has the molecular formula C28H39N2O4+ and a molecular weight of 467.63 g/mol. Its IUPAC name is [1-[(2S)-2-cyclopentyl-2-hydroxy-2-phenylacetyl]-4-hydroxypiperidin-4-yl]-[2-(4-hydroxyphenyl)ethyl]-dimethylazanium.
| Compound Name | [1-[(2S)-2-cyclopentyl-2-hydroxy-2-phenylacetyl]-4-hydroxypiperidin-4-yl]-[2-(4-hydroxyphenyl)ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 154106182 |
| Molecular Formula | C28H39N2O4+ |
| Molecular Weight | 467.63 g/mol |
| Exact Mass | 467.29 |
| IUPAC Name | [1-[(2S)-2-cyclopentyl-2-hydroxy-2-phenylacetyl]-4-hydroxypiperidin-4-yl]-[2-(4-hydroxyphenyl)ethyl]-dimethylazanium |
| SMILES | C[N+](C)(CCc1ccc(O)cc1)C1(O)CCN(C(=O)[C@@](O)(c2ccccc2)C2CCCC2)CC1 |
| InChI | InChI=1S/C28H38N2O4/c1-30(2,21-16-22-12-14-25(31)15-13-22)27(33)17-19-29(20-18-27)26(32)28(34,24-10-6-7-11-24)23-8-4-3-5-9-23/h3-5,8-9,12-15,24,33-34H,6-7,10-11,16-21H2,1-2H3/p+1/t28-/m1/s1 |
| InChIKey | CGFIUUYAIJCWBT-MUUNZHRXSA-O |
| XLogP | 3.40 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.63 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|