C30H43N2O3+ — CID 154074531
[1-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)piperidin-4-yl]-[2-(4-hydroxyphenyl)ethyl]-methyl-propylazanium (PubChem CID 154074531) has the molecular formula C30H43N2O3+ and a molecular weight of 479.69 g/mol. Its IUPAC name is [1-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)piperidin-4-yl]-[2-(4-hydroxyphenyl)ethyl]-methyl-propylazanium.
| Compound Name | [1-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)piperidin-4-yl]-[2-(4-hydroxyphenyl)ethyl]-methyl-propylazanium |
|---|---|
| PubChem CID | 154074531 |
| Molecular Formula | C30H43N2O3+ |
| Molecular Weight | 479.69 g/mol |
| Exact Mass | 479.33 |
| IUPAC Name | [1-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)piperidin-4-yl]-[2-(4-hydroxyphenyl)ethyl]-methyl-propylazanium |
| SMILES | CCC[N+](C)(CCc1ccc(O)cc1)C1CCN(C(=O)C(O)(c2ccccc2)C2CCCC2)CC1 |
| InChI | InChI=1S/C30H42N2O3/c1-3-22-32(2,23-19-24-13-15-28(33)16-14-24)27-17-20-31(21-18-27)29(34)30(35,26-11-7-8-12-26)25-9-5-4-6-10-25/h4-6,9-10,13-16,26-27,35H,3,7-8,11-12,17-23H2,1-2H3/p+1 |
| InChIKey | HRPGWHCWEXOFJL-UHFFFAOYSA-O |
| XLogP | 4.86 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.69 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|