C30H43N2O3+ — CID 154485260
[1-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)piperidin-4-yl]-[2-[4-(2-hydroxyethyl)phenyl]ethyl]-dimethylazanium (PubChem CID 154485260) has the molecular formula C30H43N2O3+ and a molecular weight of 479.69 g/mol. Its IUPAC name is [1-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)piperidin-4-yl]-[2-[4-(2-hydroxyethyl)phenyl]ethyl]-dimethylazanium.
| Compound Name | [1-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)piperidin-4-yl]-[2-[4-(2-hydroxyethyl)phenyl]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 154485260 |
| Molecular Formula | C30H43N2O3+ |
| Molecular Weight | 479.69 g/mol |
| Exact Mass | 479.33 |
| IUPAC Name | [1-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)piperidin-4-yl]-[2-[4-(2-hydroxyethyl)phenyl]ethyl]-dimethylazanium |
| SMILES | C[N+](C)(CCc1ccc(CCO)cc1)C1CCN(C(=O)C(O)(c2ccccc2)C2CCCC2)CC1 |
| InChI | InChI=1S/C30H43N2O3/c1-32(2,22-18-24-12-14-25(15-13-24)19-23-33)28-16-20-31(21-17-28)29(34)30(35,27-10-6-7-11-27)26-8-4-3-5-9-26/h3-5,8-9,12-15,27-28,33,35H,6-7,10-11,16-23H2,1-2H3/q+1 |
| InChIKey | IGRWLQMMBSYGNC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.69 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|