C26H36FN2O2S+ — CID 66555523
[1-(2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetyl)piperidin-4-yl]-[2-(4-fluorophenyl)ethyl]-dimethylazanium (PubChem CID 66555523) has the molecular formula C26H36FN2O2S+ and a molecular weight of 459.65 g/mol. Its IUPAC name is [1-(2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetyl)piperidin-4-yl]-[2-(4-fluorophenyl)ethyl]-dimethylazanium.
| Compound Name | [1-(2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetyl)piperidin-4-yl]-[2-(4-fluorophenyl)ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 66555523 |
| Molecular Formula | C26H36FN2O2S+ |
| Molecular Weight | 459.65 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | [1-(2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetyl)piperidin-4-yl]-[2-(4-fluorophenyl)ethyl]-dimethylazanium |
| SMILES | C[N+](C)(CCc1ccc(F)cc1)C1CCN(C(=O)C(O)(c2cccs2)C2CCCC2)CC1 |
| InChI | InChI=1S/C26H36FN2O2S/c1-29(2,18-15-20-9-11-22(27)12-10-20)23-13-16-28(17-14-23)25(30)26(31,21-6-3-4-7-21)24-8-5-19-32-24/h5,8-12,19,21,23,31H,3-4,6-7,13-18H2,1-2H3/q+1 |
| InChIKey | IALNOQZAFOFVME-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.65 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|