C29H40FN2O3+ — CID 25103617
[1-[2-cyclopentyl-2-(3-fluoro-4-methoxyphenyl)-2-hydroxyacetyl]piperidin-4-yl]-dimethyl-(2-phenylethyl)azanium (PubChem CID 25103617) has the molecular formula C29H40FN2O3+ and a molecular weight of 483.65 g/mol. Its IUPAC name is [1-[2-cyclopentyl-2-(3-fluoro-4-methoxyphenyl)-2-hydroxyacetyl]piperidin-4-yl]-dimethyl-(2-phenylethyl)azanium.
| Compound Name | [1-[2-cyclopentyl-2-(3-fluoro-4-methoxyphenyl)-2-hydroxyacetyl]piperidin-4-yl]-dimethyl-(2-phenylethyl)azanium |
|---|---|
| PubChem CID | 25103617 |
| Molecular Formula | C29H40FN2O3+ |
| Molecular Weight | 483.65 g/mol |
| Exact Mass | 483.30 |
| IUPAC Name | [1-[2-cyclopentyl-2-(3-fluoro-4-methoxyphenyl)-2-hydroxyacetyl]piperidin-4-yl]-dimethyl-(2-phenylethyl)azanium |
| SMILES | COc1ccc(C(O)(C(=O)N2CCC([N+](C)(C)CCc3ccccc3)CC2)C2CCCC2)cc1F |
| InChI | InChI=1S/C29H40FN2O3/c1-32(2,20-17-22-9-5-4-6-10-22)25-15-18-31(19-16-25)28(33)29(34,23-11-7-8-12-23)24-13-14-27(35-3)26(30)21-24/h4-6,9-10,13-14,21,23,25,34H,7-8,11-12,15-20H2,1-3H3/q+1 |
| InChIKey | LXIKNWJSXWHEKH-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.65 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|