C28H39N2O4+ — CID 154070254
[1-[(2R)-2-cyclopentyl-2-hydroxy-2-phenylacetyl]piperidin-4-yl]-[2-hydroxy-2-(2-hydroxyphenyl)ethyl]-dimethylazanium (PubChem CID 154070254) has the molecular formula C28H39N2O4+ and a molecular weight of 467.63 g/mol. Its IUPAC name is [1-[(2R)-2-cyclopentyl-2-hydroxy-2-phenylacetyl]piperidin-4-yl]-[2-hydroxy-2-(2-hydroxyphenyl)ethyl]-dimethylazanium.
| Compound Name | [1-[(2R)-2-cyclopentyl-2-hydroxy-2-phenylacetyl]piperidin-4-yl]-[2-hydroxy-2-(2-hydroxyphenyl)ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 154070254 |
| Molecular Formula | C28H39N2O4+ |
| Molecular Weight | 467.63 g/mol |
| Exact Mass | 467.29 |
| IUPAC Name | [1-[(2R)-2-cyclopentyl-2-hydroxy-2-phenylacetyl]piperidin-4-yl]-[2-hydroxy-2-(2-hydroxyphenyl)ethyl]-dimethylazanium |
| SMILES | C[N+](C)(CC(O)c1ccccc1O)C1CCN(C(=O)[C@](O)(c2ccccc2)C2CCCC2)CC1 |
| InChI | InChI=1S/C28H38N2O4/c1-30(2,20-26(32)24-14-8-9-15-25(24)31)23-16-18-29(19-17-23)27(33)28(34,22-12-6-7-13-22)21-10-4-3-5-11-21/h3-5,8-11,14-15,22-23,26,32,34H,6-7,12-13,16-20H2,1-2H3/p+1/t26?,28-/m0/s1 |
| InChIKey | CJZWRBJEOCZQPW-RXBHZZDJSA-O |
| XLogP | 3.57 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.63 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|