C21H25NO3 — CID 67195129
1-piperidin-4-ylethyl 2-hydroxy-2,2-diphenylacetate (PubChem CID 67195129) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is 1-piperidin-4-ylethyl 2-hydroxy-2,2-diphenylacetate.
| Compound Name | 1-piperidin-4-ylethyl 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 67195129 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 1-piperidin-4-ylethyl 2-hydroxy-2,2-diphenylacetate |
| SMILES | CC(OC(=O)C(O)(c1ccccc1)c1ccccc1)C1CCNCC1 |
| InChI | InChI=1S/C21H25NO3/c1-16(17-12-14-22-15-13-17)25-20(23)21(24,18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-11,16-17,22,24H,12-15H2,1H3 |
| InChIKey | FGKWHKVHGUPVDW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |