C20H23NO3 — CID 67195730
[(1S)-1-pyrrolidin-2-ylethyl] 2-hydroxy-2,2-diphenylacetate (PubChem CID 67195730) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is [(1S)-1-pyrrolidin-2-ylethyl] 2-hydroxy-2,2-diphenylacetate.
| Compound Name | [(1S)-1-pyrrolidin-2-ylethyl] 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 67195730 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | [(1S)-1-pyrrolidin-2-ylethyl] 2-hydroxy-2,2-diphenylacetate |
| SMILES | C[C@H](OC(=O)C(O)(c1ccccc1)c1ccccc1)C1CCCN1 |
| InChI | InChI=1S/C20H23NO3/c1-15(18-13-8-14-21-18)24-19(22)20(23,16-9-4-2-5-10-16)17-11-6-3-7-12-17/h2-7,9-12,15,18,21,23H,8,13-14H2,1H3/t15-,18?/m0/s1 |
| InChIKey | BHDBWVZVMHMAPJ-BUSXIPJBSA-N |
| XLogP | 2.61 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |