C25H35N — CID 59628644
(2S)-2-[bis(4-tert-butylphenyl)methyl]pyrrolidine (PubChem CID 59628644) has the molecular formula C25H35N and a molecular weight of 349.56 g/mol. Its IUPAC name is (2S)-2-[bis(4-tert-butylphenyl)methyl]pyrrolidine.
| Compound Name | (2S)-2-[bis(4-tert-butylphenyl)methyl]pyrrolidine |
|---|---|
| PubChem CID | 59628644 |
| Molecular Formula | C25H35N |
| Molecular Weight | 349.56 g/mol |
| Exact Mass | 349.28 |
| IUPAC Name | (2S)-2-[bis(4-tert-butylphenyl)methyl]pyrrolidine |
| SMILES | CC(C)(C)c1ccc(C(c2ccc(C(C)(C)C)cc2)[C@@H]2CCCN2)cc1 |
| InChI | InChI=1S/C25H35N/c1-24(2,3)20-13-9-18(10-14-20)23(22-8-7-17-26-22)19-11-15-21(16-12-19)25(4,5)6/h9-16,22-23,26H,7-8,17H2,1-6H3/t22-/m0/s1 |
| InChIKey | YUZYHLKNIXUHLP-QFIPXVFZSA-N |
| XLogP | 6.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.56 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |