C38H45N — CID 59628977
(2S)-2-[bis[4-[2-(4-methylphenyl)propan-2-yl]phenyl]methyl]piperidine (PubChem CID 59628977) has the molecular formula C38H45N and a molecular weight of 515.79 g/mol. Its IUPAC name is (2S)-2-[bis[4-[2-(4-methylphenyl)propan-2-yl]phenyl]methyl]piperidine.
| Compound Name | (2S)-2-[bis[4-[2-(4-methylphenyl)propan-2-yl]phenyl]methyl]piperidine |
|---|---|
| PubChem CID | 59628977 |
| Molecular Formula | C38H45N |
| Molecular Weight | 515.79 g/mol |
| Exact Mass | 515.36 |
| IUPAC Name | (2S)-2-[bis[4-[2-(4-methylphenyl)propan-2-yl]phenyl]methyl]piperidine |
| SMILES | Cc1ccc(C(C)(C)c2ccc(C(c3ccc(C(C)(C)c4ccc(C)cc4)cc3)[C@@H]3CCCCN3)cc2)cc1 |
| InChI | InChI=1S/C38H45N/c1-27-10-18-31(19-11-27)37(3,4)33-22-14-29(15-23-33)36(35-9-7-8-26-39-35)30-16-24-34(25-17-30)38(5,6)32-20-12-28(2)13-21-32/h10-25,35-36,39H,7-9,26H2,1-6H3/t35-/m0/s1 |
| InChIKey | UZVVPYKGCQPEDR-DHUJRADRSA-N |
| XLogP | 9.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.79 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |