About (2R)-2-[bis(3,5-ditert-butylphenyl)methyl]pyrrolidine
(2R)-2-[bis(3,5-ditert-butylphenyl)methyl]pyrrolidine (PubChem CID 59628646) has the molecular formula C33H51N
and a molecular weight of 461.78 g/mol. Its IUPAC name is (2R)-2-[bis(3,5-ditert-butylphenyl)methyl]pyrrolidine.
Molecular Properties
| Compound Name | (2R)-2-[bis(3,5-ditert-butylphenyl)methyl]pyrrolidine |
| PubChem CID | 59628646 |
| Molecular Formula | C33H51N |
| Molecular Weight | 461.78 g/mol |
| Exact Mass | 461.40 |
| IUPAC Name | (2R)-2-[bis(3,5-ditert-butylphenyl)methyl]pyrrolidine |
| SMILES | CC(C)(C)c1cc(C(c2cc(C(C)(C)C)cc(C(C)(C)C)c2)[C@H]2CCCN2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C33H51N/c1-30(2,3)24-16-22(17-25(20-24)31(4,5)6)29(28-14-13-15-34-28)23-18-26(32(7,8)9)21-27(19-23)33(10,11)12/h16-21,28-29,34H,13-15H2,1-12H3/t28-/m1/s1 |
| InChIKey | MUZCBXDLHQDONA-MUUNZHRXSA-N |
| XLogP | 8.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 461.78 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R)-2-[bis(3,5-ditert-butylphenyl)methyl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[bis(3,5-ditert-butylphenyl)methyl]pyrrolidine?
The IUPAC name of (2R)-2-[bis(3,5-ditert-butylphenyl)methyl]pyrrolidine (CID 59628646) is (2R)-2-[bis(3,5-ditert-butylphenyl)methyl]pyrrolidine.
What is the SMILES notation for (2R)-2-[bis(3,5-ditert-butylphenyl)methyl]pyrrolidine?
The canonical SMILES for (2R)-2-[bis(3,5-ditert-butylphenyl)methyl]pyrrolidine is CC(C)(C)c1cc(C(c2cc(C(C)(C)C)cc(C(C)(C)C)c2)[C@H]2CCCN2)cc(C(C)(C)C)c1.
What is the InChIKey of (2R)-2-[bis(3,5-ditert-butylphenyl)methyl]pyrrolidine?
The InChIKey is MUZCBXDLHQDONA-MUUNZHRXSA-N. The full InChI is InChI=1S/C33H51N/c1-30(2,3)24-16-22(17-25(20-24)31(4,5)6)29(28-14-13-15-34-28)23-18-26(32(7,8)9)21-27(19-23)33(10,11)12/h16-21,28-29,34H,13-15H2,1-12H3/t28-/m1/s1.
What are the key properties of (2R)-2-[bis(3,5-ditert-butylphenyl)methyl]pyrrolidine?
(2R)-2-[bis(3,5-ditert-butylphenyl)methyl]pyrrolidine has a molecular weight of 461.78 g/mol, XLogP of 8.76, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[bis(3,5-ditert-butylphenyl)methyl]pyrrolidine is sourced from PubChem (CID 59628646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).