C33H51N — CID 59628646
(2R)-2-[bis(3,5-ditert-butylphenyl)methyl]pyrrolidine (PubChem CID 59628646) has the molecular formula C33H51N and a molecular weight of 461.78 g/mol. Its IUPAC name is (2R)-2-[bis(3,5-ditert-butylphenyl)methyl]pyrrolidine.
| Compound Name | (2R)-2-[bis(3,5-ditert-butylphenyl)methyl]pyrrolidine |
|---|---|
| PubChem CID | 59628646 |
| Molecular Formula | C33H51N |
| Molecular Weight | 461.78 g/mol |
| Exact Mass | 461.40 |
| IUPAC Name | (2R)-2-[bis(3,5-ditert-butylphenyl)methyl]pyrrolidine |
| SMILES | CC(C)(C)c1cc(C(c2cc(C(C)(C)C)cc(C(C)(C)C)c2)[C@H]2CCCN2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C33H51N/c1-30(2,3)24-16-22(17-25(20-24)31(4,5)6)29(28-14-13-15-34-28)23-18-26(32(7,8)9)21-27(19-23)33(10,11)12/h16-21,28-29,34H,13-15H2,1-12H3/t28-/m1/s1 |
| InChIKey | MUZCBXDLHQDONA-MUUNZHRXSA-N |
| XLogP | 8.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.78 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |