C37H43N — CID 59629015
(2S)-2-[bis[4-[2-(4-methylphenyl)propan-2-yl]phenyl]methyl]pyrrolidine (PubChem CID 59629015) has the molecular formula C37H43N and a molecular weight of 501.76 g/mol. Its IUPAC name is (2S)-2-[bis[4-[2-(4-methylphenyl)propan-2-yl]phenyl]methyl]pyrrolidine.
| Compound Name | (2S)-2-[bis[4-[2-(4-methylphenyl)propan-2-yl]phenyl]methyl]pyrrolidine |
|---|---|
| PubChem CID | 59629015 |
| Molecular Formula | C37H43N |
| Molecular Weight | 501.76 g/mol |
| Exact Mass | 501.34 |
| IUPAC Name | (2S)-2-[bis[4-[2-(4-methylphenyl)propan-2-yl]phenyl]methyl]pyrrolidine |
| SMILES | Cc1ccc(C(C)(C)c2ccc(C(c3ccc(C(C)(C)c4ccc(C)cc4)cc3)[C@@H]3CCCN3)cc2)cc1 |
| InChI | InChI=1S/C37H43N/c1-26-9-17-30(18-10-26)36(3,4)32-21-13-28(14-22-32)35(34-8-7-25-38-34)29-15-23-33(24-16-29)37(5,6)31-19-11-27(2)12-20-31/h9-24,34-35,38H,7-8,25H2,1-6H3/t34-/m0/s1 |
| InChIKey | WCPOFLSESHMBBF-UMSFTDKQSA-N |
| XLogP | 8.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.76 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |