C29H33IN2O2 — CID 25031465
2-hydroxy-N-[[3-methyl-3-[(4-methylphenyl)methyl]-3-azoniabicyclo[3.1.0]hexan-6-yl]methyl]-2,2-diphenylacetamide iodide (PubChem CID 25031465) has the molecular formula C29H33IN2O2 and a molecular weight of 568.50 g/mol. Its IUPAC name is 2-hydroxy-N-[[3-methyl-3-[(4-methylphenyl)methyl]-3-azoniabicyclo[3.1.0]hexan-6-yl]methyl]-2,2-diphenylacetamide iodide.
| Compound Name | 2-hydroxy-N-[[3-methyl-3-[(4-methylphenyl)methyl]-3-azoniabicyclo[3.1.0]hexan-6-yl]methyl]-2,2-diphenylacetamide iodide |
|---|---|
| PubChem CID | 25031465 |
| Molecular Formula | C29H33IN2O2 |
| Molecular Weight | 568.50 g/mol |
| Exact Mass | 568.16 |
| IUPAC Name | 2-hydroxy-N-[[3-methyl-3-[(4-methylphenyl)methyl]-3-azoniabicyclo[3.1.0]hexan-6-yl]methyl]-2,2-diphenylacetamide iodide |
| SMILES | Cc1ccc(C[N+]2(C)CC3C(CNC(=O)C(O)(c4ccccc4)c4ccccc4)C3C2)cc1.[I-] |
| InChI | InChI=1S/C29H32N2O2.HI/c1-21-13-15-22(16-14-21)18-31(2)19-26-25(27(26)20-31)17-30-28(32)29(33,23-9-5-3-6-10-23)24-11-7-4-8-12-24;/h3-16,25-27,33H,17-20H2,1-2H3;1H |
| InChIKey | WKVMURNRAIVWIL-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.50 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|