C23H30NO4+ — CID 23336653
(1,1-dimethylpyrrolidin-1-ium-3-yl) 2-(2-hydroxyethoxy)-2-(4-methylphenyl)-2-phenylacetate (PubChem CID 23336653) has the molecular formula C23H30NO4+ and a molecular weight of 384.50 g/mol. Its IUPAC name is (1,1-dimethylpyrrolidin-1-ium-3-yl) 2-(2-hydroxyethoxy)-2-(4-methylphenyl)-2-phenylacetate.
| Compound Name | (1,1-dimethylpyrrolidin-1-ium-3-yl) 2-(2-hydroxyethoxy)-2-(4-methylphenyl)-2-phenylacetate |
|---|---|
| PubChem CID | 23336653 |
| Molecular Formula | C23H30NO4+ |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | (1,1-dimethylpyrrolidin-1-ium-3-yl) 2-(2-hydroxyethoxy)-2-(4-methylphenyl)-2-phenylacetate |
| SMILES | Cc1ccc(C(OCCO)(C(=O)OC2CC[N+](C)(C)C2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H30NO4/c1-18-9-11-20(12-10-18)23(27-16-15-25,19-7-5-4-6-8-19)22(26)28-21-13-14-24(2,3)17-21/h4-12,21,25H,13-17H2,1-3H3/q+1 |
| InChIKey | BIDZPFACTNUEMV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|