C21H28NO5+ — CID 23336655
(1,1-dimethylpyrrolidin-1-ium-3-yl) 2-(furan-2-yl)-2-(3-hydroxypropoxy)-2-phenylacetate (PubChem CID 23336655) has the molecular formula C21H28NO5+ and a molecular weight of 374.46 g/mol. Its IUPAC name is (1,1-dimethylpyrrolidin-1-ium-3-yl) 2-(furan-2-yl)-2-(3-hydroxypropoxy)-2-phenylacetate.
| Compound Name | (1,1-dimethylpyrrolidin-1-ium-3-yl) 2-(furan-2-yl)-2-(3-hydroxypropoxy)-2-phenylacetate |
|---|---|
| PubChem CID | 23336655 |
| Molecular Formula | C21H28NO5+ |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | (1,1-dimethylpyrrolidin-1-ium-3-yl) 2-(furan-2-yl)-2-(3-hydroxypropoxy)-2-phenylacetate |
| SMILES | C[N+]1(C)CCC(OC(=O)C(OCCCO)(c2ccccc2)c2ccco2)C1 |
| InChI | InChI=1S/C21H28NO5/c1-22(2)12-11-18(16-22)27-20(24)21(26-15-7-13-23,19-10-6-14-25-19)17-8-4-3-5-9-17/h3-6,8-10,14,18,23H,7,11-13,15-16H2,1-2H3/q+1 |
| InChIKey | VCKYQOLWOIAXBX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|