C24H32NO3+ — CID 72793860
(1,1-dimethylpiperidin-1-ium-4-yl) 2,2-diphenyl-2-propoxyacetate (PubChem CID 72793860) has the molecular formula C24H32NO3+ and a molecular weight of 382.52 g/mol. Its IUPAC name is (1,1-dimethylpiperidin-1-ium-4-yl) 2,2-diphenyl-2-propoxyacetate.
| Compound Name | (1,1-dimethylpiperidin-1-ium-4-yl) 2,2-diphenyl-2-propoxyacetate |
|---|---|
| PubChem CID | 72793860 |
| Molecular Formula | C24H32NO3+ |
| Molecular Weight | 382.52 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | (1,1-dimethylpiperidin-1-ium-4-yl) 2,2-diphenyl-2-propoxyacetate |
| SMILES | CCCOC(C(=O)OC1CC[N+](C)(C)CC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H32NO3/c1-4-19-27-24(20-11-7-5-8-12-20,21-13-9-6-10-14-21)23(26)28-22-15-17-25(2,3)18-16-22/h5-14,22H,4,15-19H2,1-3H3/q+1 |
| InChIKey | UOSMTHHNBVXIKL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.52 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|