C22H27NO3 — CID 71696334
piperidin-4-yl 2,2-diphenyl-2-(1,1,2,2-tetradeuteriopropoxy)acetate (PubChem CID 71696334) has the molecular formula C22H27NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is piperidin-4-yl 2,2-diphenyl-2-(1,1,2,2-tetradeuteriopropoxy)acetate.
| Compound Name | piperidin-4-yl 2,2-diphenyl-2-(1,1,2,2-tetradeuteriopropoxy)acetate |
|---|---|
| PubChem CID | 71696334 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | piperidin-4-yl 2,2-diphenyl-2-(1,1,2,2-tetradeuteriopropoxy)acetate |
| SMILES | [2H]C([2H])(C)C([2H])([2H])OC(C(=O)OC1CCNCC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H27NO3/c1-2-17-25-22(18-9-5-3-6-10-18,19-11-7-4-8-12-19)21(24)26-20-13-15-23-16-14-20/h3-12,20,23H,2,13-17H2,1H3/i2D2,17D2 |
| InChIKey | FMRVAGKPRZLTRG-NQXIXQKGSA-N |
| XLogP | 3.65 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |