C27H35NO5 — CID 177226566
1-(2-cycloheptyloxy-2-oxo-1,1-diphenylethoxy)propyl (2S)-2-aminopropanoate (PubChem CID 177226566) has the molecular formula C27H35NO5 and a molecular weight of 453.58 g/mol. Its IUPAC name is 1-(2-cycloheptyloxy-2-oxo-1,1-diphenylethoxy)propyl (2S)-2-aminopropanoate.
| Compound Name | 1-(2-cycloheptyloxy-2-oxo-1,1-diphenylethoxy)propyl (2S)-2-aminopropanoate |
|---|---|
| PubChem CID | 177226566 |
| Molecular Formula | C27H35NO5 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | 1-(2-cycloheptyloxy-2-oxo-1,1-diphenylethoxy)propyl (2S)-2-aminopropanoate |
| SMILES | CCC(OC(=O)[C@H](C)N)OC(C(=O)OC1CCCCCC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H35NO5/c1-3-24(32-25(29)20(2)28)33-27(21-14-8-6-9-15-21,22-16-10-7-11-17-22)26(30)31-23-18-12-4-5-13-19-23/h6-11,14-17,20,23-24H,3-5,12-13,18-19,28H2,1-2H3/t20-,24?/m0/s1 |
| InChIKey | OHUCEPFOBUZBSI-QHELBMECSA-N |
| XLogP | 4.84 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|